EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O3 |
| Net Charge | 0 |
| Average Mass | 90.078 |
| Monoisotopic Mass | 90.03169 |
| SMILES | C[C@@H](O)C(=O)O |
| InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m1/s1 |
| InChIKey | JVTAAEKCZFNVCJ-UWTATZPHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-lactic acid (CHEBI:42111) has role Escherichia coli metabolite (CHEBI:76971) |
| (R)-lactic acid (CHEBI:42111) has role human metabolite (CHEBI:77746) |
| (R)-lactic acid (CHEBI:42111) is a 2-hydroxypropanoic acid (CHEBI:78320) |
| (R)-lactic acid (CHEBI:42111) is conjugate acid of (R)-lactate (CHEBI:16004) |
| (R)-lactic acid (CHEBI:42111) is enantiomer of (S)-lactic acid (CHEBI:422) |
| Incoming Relation(s) |
| (R)-S-lactoylglutathione (CHEBI:15694) has functional parent (R)-lactic acid (CHEBI:42111) |
| (R)-lactoyl-CoA (CHEBI:71164) has functional parent (R)-lactic acid (CHEBI:42111) |
| D-alanyl-(R)-lactic acid (CHEBI:61163) has functional parent (R)-lactic acid (CHEBI:42111) |
| D-prephenyl lactate (CHEBI:27441) has functional parent (R)-lactic acid (CHEBI:42111) |
| ethyl (2R)-lactate (CHEBI:78323) has functional parent (R)-lactic acid (CHEBI:42111) |
| methyl (R)-lactate (CHEBI:74611) has functional parent (R)-lactic acid (CHEBI:42111) |
| rac-lactic acid (CHEBI:28358) has part (R)-lactic acid (CHEBI:42111) |
| (R)-lactate (CHEBI:16004) is conjugate base of (R)-lactic acid (CHEBI:42111) |
| (S)-lactic acid (CHEBI:422) is enantiomer of (R)-lactic acid (CHEBI:42111) |
| (R)-lactoyl group (CHEBI:149487) is substituent group from (R)-lactic acid (CHEBI:42111) |
| IUPAC Name |
|---|
| (2R)-2-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| D-Lactic acid | KEGG COMPOUND |
| D-2-Hydroxypropanoic acid | KEGG COMPOUND |
| D-2-Hydroxypropionic acid | KEGG COMPOUND |
| D-lactic acid | ChemIDplus |
| (−)-lactic acid | ChemIDplus |
| (R)-(−)-lactic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00256 | KEGG COMPOUND |
| LAC | PDBeChem |
| DB04398 | DrugBank |
| HMDB0001311 | HMDB |
| Lactic_acid | Wikipedia |
| DB03066 | DrugBank |
| C00019549 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1720252 | Beilstein |
| Gmelin:362718 | Gmelin |
| Reaxys:1720252 | Reaxys |
| CAS:10326-41-7 | KEGG COMPOUND |
| CAS:10326-41-7 | ChemIDplus |
| Citations |
|---|