EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | COC(=O)[C@@H](C)O |
| InChI | InChI=1S/C4H8O3/c1-3(5)4(6)7-2/h3,5H,1-2H3/t3-/m1/s1 |
| InChIKey | LPEKGGXMPWTOCB-GSVOUGTGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (R)-lactate (CHEBI:74611) has functional parent (R)-lactic acid (CHEBI:42111) |
| methyl (R)-lactate (CHEBI:74611) is a methyl 2-hydroxypropionate (CHEBI:83221) |
| methyl (R)-lactate (CHEBI:74611) is enantiomer of methyl (S)-lactate (CHEBI:83222) |
| Incoming Relation(s) |
| rac-methyl lactate (CHEBI:73641) has part methyl (R)-lactate (CHEBI:74611) |
| methyl (S)-lactate (CHEBI:83222) is enantiomer of methyl (R)-lactate (CHEBI:74611) |
| IUPAC Name |
|---|
| methyl (2R)-2-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| D-lactic acid methyl ester | MetaCyc |
| methyl (R)-(+)-lactate | ChEBI |
| D-lactate methyl ester | MetaCyc |
| (+)-methyl lactate | ChEBI |
| (+)-2-hydroxypropanoic acid methyl ester | ChEBI |
| (R)-(+)-lactic acid methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-3621 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720588 | Reaxys |
| CAS:17392-83-5 | NIST Chemistry WebBook |