EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O8 |
| Net Charge | 0 |
| Average Mass | 298.247 |
| Monoisotopic Mass | 298.06887 |
| SMILES | C[C@@H](O)C(=O)O[C@H]1C=C[C@@](CC(=O)C(=O)O)(C(=O)O)C=C1 |
| InChI | InChI=1S/C13H14O8/c1-7(14)11(18)21-8-2-4-13(5-3-8,12(19)20)6-9(15)10(16)17/h2-5,7-8,14H,6H2,1H3,(H,16,17)(H,19,20)/t7-,8-,13+/m1/s1 |
| InChIKey | LNGMWZFHTXFDNM-RBDZCENOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-prephenyl lactate (CHEBI:27441) has functional parent (R)-lactic acid (CHEBI:42111) |
| D-prephenyl lactate (CHEBI:27441) is a lactate ester (CHEBI:83219) |
| D-prephenyl lactate (CHEBI:27441) is a oxo dicarboxylic acid (CHEBI:36145) |
| IUPAC Name |
|---|
| cis-1-(2-carboxy-2-oxoethyl)-4-{[(2R)-2-hydroxypropanoyl]oxy}cyclohexa-2,5-diene-1-carboxylic acid |
| Synonym | Source |
|---|---|
| D-Prephenyllactate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00994 | KEGG COMPOUND |