EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:16296 - D-tryptophan
| Formula | C11H12N2O2 |
| Net Charge | 0 |
| Average Mass | 204.229 |
| Monoisotopic Mass | 204.08988 |
| SMILES | N[C@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | QIVBCDIJIAJPQS-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tryptophan (CHEBI:16296) has role bacterial metabolite (CHEBI:76969) |
| D-tryptophan (CHEBI:16296) is a D-α-amino acid (CHEBI:16733) |
| D-tryptophan (CHEBI:16296) is a tryptophan (CHEBI:27897) |
| D-tryptophan (CHEBI:16296) is conjugate acid of D-tryptophanate (CHEBI:32716) |
| D-tryptophan (CHEBI:16296) is conjugate base of D-tryptophanium (CHEBI:32717) |
| D-tryptophan (CHEBI:16296) is enantiomer of L-tryptophan (CHEBI:16828) |
| D-tryptophan (CHEBI:16296) is tautomer of D-tryptophan zwitterion (CHEBI:57719) |
| Incoming Relation(s) |
| D-tryptophan derivative (CHEBI:47997) has functional parent D-tryptophan (CHEBI:16296) |
| D-tryptophanyl radical (CHEBI:32723) has functional parent D-tryptophan (CHEBI:16296) |
| D-tryptophanyl radical cation (CHEBI:32724) has functional parent D-tryptophan (CHEBI:16296) |
| D-tryptophanium (CHEBI:32717) is conjugate acid of D-tryptophan (CHEBI:16296) |
| D-tryptophanate (CHEBI:32716) is conjugate base of D-tryptophan (CHEBI:16296) |
| L-tryptophan (CHEBI:16828) is enantiomer of D-tryptophan (CHEBI:16296) |
| D-tryptophan residue (CHEBI:29955) is substituent group from D-tryptophan (CHEBI:16296) |
| D-tryptophano group (CHEBI:32719) is substituent group from D-tryptophan (CHEBI:16296) |
| D-tryptophyl group (CHEBI:32718) is substituent group from D-tryptophan (CHEBI:16296) |
| 1-D-tryptophano group (CHEBI:32720) is substituent group from D-tryptophan (CHEBI:16296) |
| D-tryptophan zwitterion (CHEBI:57719) is tautomer of D-tryptophan (CHEBI:16296) |
| IUPAC Name |
|---|
| D-tryptophan |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(1H-indol-3-yl)propanoic acid | IUPAC |
| DTR | PDBeChem |
| D-Tryptophan | KEGG COMPOUND |
| D-TRYPTOPHAN | PDBeChem |
| (R)-tryptophan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00525 | KEGG COMPOUND |
| DB03225 | DrugBank |
| DTR | PDBeChem |
| D-TRYPTOPHAN | MetaCyc |
| HMDB0013609 | HMDB |
| YMDB00998 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:83743 | Gmelin |
| Reaxys:86198 | Reaxys |
| CAS:153-94-6 | KEGG COMPOUND |
| CAS:153-94-6 | ChemIDplus |
| Citations |
|---|