EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N2O2 |
| Net Charge | 0 |
| Average Mass | 203.221 |
| Monoisotopic Mass | 203.08205 |
| SMILES | *N[C@H](Cc1cnc2ccccc12)C(=O)O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tryptophano group (CHEBI:32719) is a tryptophano group (CHEBI:27165) |
| D-tryptophano group (CHEBI:32719) is enantiomer of L-tryptophano group (CHEBI:32708) |
| D-tryptophano group (CHEBI:32719) is substituent group from D-tryptophan (CHEBI:16296) |
| Incoming Relation(s) |
| L-tryptophano group (CHEBI:32708) is enantiomer of D-tryptophano group (CHEBI:32719) |
| IUPAC Name |
|---|
| [(1R)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino |
| Synonyms | Source |
|---|---|
| Nα-D-tryptophano | ChEBI |
| -D-Trp | JCBN |
| D-tryptophano | JCBN |