EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N2O |
| Net Charge | 0 |
| Average Mass | 187.222 |
| Monoisotopic Mass | 187.08714 |
| SMILES | *C(=O)[C@H](N)Cc1cnc2ccccc12 |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tryptophyl group (CHEBI:32718) is a tryptophyl group (CHEBI:37899) |
| D-tryptophyl group (CHEBI:32718) is enantiomer of L-tryptophyl group (CHEBI:32706) |
| D-tryptophyl group (CHEBI:32718) is substituent group from D-tryptophan (CHEBI:16296) |
| Incoming Relation(s) |
| L-tryptophyl group (CHEBI:32706) is enantiomer of D-tryptophyl group (CHEBI:32718) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-(1H-indol-3-yl)propanoyl |
| Synonyms | Source |
|---|---|
| D-Trp- | JCBN |
| D-tryptophyl | JCBN |