EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N2O2 |
| Net Charge | +1 |
| Average Mass | 205.237 |
| Monoisotopic Mass | 205.09715 |
| SMILES | [NH3+][C@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/p+1/t9-/m1/s1 |
| InChIKey | QIVBCDIJIAJPQS-SECBINFHSA-O |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tryptophanium (CHEBI:32717) has role bacterial metabolite (CHEBI:76969) |
| D-tryptophanium (CHEBI:32717) is a tryptophanium (CHEBI:32728) |
| D-tryptophanium (CHEBI:32717) is conjugate acid of D-tryptophan (CHEBI:16296) |
| D-tryptophanium (CHEBI:32717) is enantiomer of L-tryptophanium (CHEBI:32704) |
| Incoming Relation(s) |
| D-tryptophan (CHEBI:16296) is conjugate base of D-tryptophanium (CHEBI:32717) |
| L-tryptophanium (CHEBI:32704) is enantiomer of D-tryptophanium (CHEBI:32717) |
| IUPAC Name |
|---|
| D-tryptophanium |
| Synonyms | Source |
|---|---|
| (1R)-1-carboxy-2-(1H-indol-3-yl)ethanaminium | IUPAC |
| D-tryptophan cation | JCBN |