EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:27897 - tryptophan
| Formula | C11H12N2O2 |
| Net Charge | 0 |
| Average Mass | 204.229 |
| Monoisotopic Mass | 204.08988 |
| SMILES | NC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptophan (CHEBI:27897) has part 1H-indol-3-ylmethyl group (CHEBI:50337) |
| tryptophan (CHEBI:27897) has role Daphnia magna metabolite (CHEBI:83056) |
| tryptophan (CHEBI:27897) is a aminoalkylindole (CHEBI:38631) |
| tryptophan (CHEBI:27897) is a aromatic amino acid (CHEBI:33856) |
| tryptophan (CHEBI:27897) is a polar amino acid (CHEBI:26167) |
| tryptophan (CHEBI:27897) is a α-amino acid (CHEBI:33704) |
| tryptophan (CHEBI:27897) is conjugate acid of tryptophanate (CHEBI:32727) |
| tryptophan (CHEBI:27897) is conjugate base of tryptophanium (CHEBI:32728) |
| tryptophan (CHEBI:27897) is tautomer of tryptophan zwitterion (CHEBI:64554) |
| Incoming Relation(s) |
| tryptophan derivative (CHEBI:27164) has functional parent tryptophan (CHEBI:27897) |
| tryptophanyl radical (CHEBI:32730) has functional parent tryptophan (CHEBI:27897) |
| tryptophanyl radical cation (CHEBI:32729) has functional parent tryptophan (CHEBI:27897) |
| D-tryptophan (CHEBI:16296) is a tryptophan (CHEBI:27897) |
| L-tryptophan (CHEBI:16828) is a tryptophan (CHEBI:27897) |
| tryptophanium (CHEBI:32728) is conjugate acid of tryptophan (CHEBI:27897) |
| tryptophanate (CHEBI:32727) is conjugate base of tryptophan (CHEBI:27897) |
| 1-tryptophano group (CHEBI:32731) is substituent group from tryptophan (CHEBI:27897) |
| tryptophan residue (CHEBI:32732) is substituent group from tryptophan (CHEBI:27897) |
| tryptophano group (CHEBI:27165) is substituent group from tryptophan (CHEBI:27897) |
| tryptophyl group (CHEBI:37899) is substituent group from tryptophan (CHEBI:27897) |
| tryptophan zwitterion (CHEBI:64554) is tautomer of tryptophan (CHEBI:27897) |
| IUPAC Name |
|---|
| tryptophan |
| Synonyms | Source |
|---|---|
| 2-amino-3-(1H-indol-3-yl)propanoic acid | IUPAC |
| alpha-Amino-beta-(3-indolyl)-propionic acid | KEGG COMPOUND |
| Htrp | IUPAC |
| triptófano | ChEBI |
| Trp | ChEBI |
| Tryptophan | KEGG COMPOUND |
| Citations |
|---|