EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N2O2 |
| Net Charge | 0 |
| Average Mass | 203.221 |
| Monoisotopic Mass | 203.08205 |
| SMILES | N[C@H](CC1=C[N]c2ccccc21)C(=O)O |
| InChI | InChI=1S/C11H11N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9H,5,12H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | UMQXPTSGLUXAQK-SECBINFHSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tryptophanyl radical (CHEBI:32723) has functional parent D-tryptophan (CHEBI:16296) |
| D-tryptophanyl radical (CHEBI:32723) has role bacterial metabolite (CHEBI:76969) |
| D-tryptophanyl radical (CHEBI:32723) is a D-amino acid radical (CHEBI:33546) |
| D-tryptophanyl radical (CHEBI:32723) is a tryptophanyl radical (CHEBI:32730) |
| D-tryptophanyl radical (CHEBI:32723) is conjugate base of D-tryptophanyl radical cation (CHEBI:32724) |
| D-tryptophanyl radical (CHEBI:32723) is enantiomer of L-tryptophanyl radical (CHEBI:32712) |
| Incoming Relation(s) |
| D-tryptophanyl radical cation (CHEBI:32724) is conjugate acid of D-tryptophanyl radical (CHEBI:32723) |
| L-tryptophanyl radical (CHEBI:32712) is enantiomer of D-tryptophanyl radical (CHEBI:32723) |
| D-tryptophanyl radical residue (CHEBI:32725) is substituent group from D-tryptophanyl radical (CHEBI:32723) |
| IUPAC Name |
|---|
| 3-[(2R)-2-amino-2-carboxyethyl]-1H-indol-1-yl |
| Synonyms | Source |
|---|---|
| D-tryptophan(•) | ChEBI |
| D-tryptophan radical | ChEBI |