EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O |
| Net Charge | 0 |
| Average Mass | 182.222 |
| Monoisotopic Mass | 182.07316 |
| SMILES | O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzophenone (CHEBI:41308) has role photosensitizing agent (CHEBI:47868) |
| benzophenone (CHEBI:41308) has role plant metabolite (CHEBI:76924) |
| benzophenone (CHEBI:41308) is a benzophenones (CHEBI:22726) |
| Incoming Relation(s) |
| demethylsulochrin (CHEBI:48948) has functional parent benzophenone (CHEBI:41308) |
| fenofibrate (CHEBI:5001) has functional parent benzophenone (CHEBI:41308) |
| mesotrione (CHEBI:38321) has functional parent benzophenone (CHEBI:41308) |
| Ro 48-8071 (CHEBI:101064) has functional parent benzophenone (CHEBI:41308) |
| IUPAC Names |
|---|
| benzophenone |
| diphenylmethanone |
| Synonyms | Source |
|---|---|
| Benzophenone | KEGG COMPOUND |
| Diphenyl ketone | KEGG COMPOUND |
| benzoylbenzene | NIST Chemistry WebBook |
| DIPHENYLMETHANONE | PDBeChem |
| α-oxodiphenylmethane | NIST Chemistry WebBook |
| α-oxoditane | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| benzophenone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C06354 | KEGG COMPOUND |
| BZQ | PDBeChem |
| DB01878 | DrugBank |
| Benzophenone | Wikipedia |
| HMDB0032049 | HMDB |
| 2991 | ChemSpider |
| Citations |
|---|