EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COc1cc(O)cc(C(=O)O)c1C(=O)c1c(O)cc(C)cc1O |
| InChI | InChI=1S/C16H14O7/c1-7-3-10(18)14(11(19)4-7)15(20)13-9(16(21)22)5-8(17)6-12(13)23-2/h3-6,17-19H,1-2H3,(H,21,22) |
| InChIKey | XMNMFMYKFRXRFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethylsulochrin (CHEBI:48948) has functional parent benzophenone (CHEBI:41308) |
| demethylsulochrin (CHEBI:48948) is a benzoic acids (CHEBI:22723) |
| demethylsulochrin (CHEBI:48948) is conjugate acid of demethylsulochrin(1−) (CHEBI:58760) |
| Incoming Relation(s) |
| sulochrin (CHEBI:16159) has functional parent demethylsulochrin (CHEBI:48948) |
| demethylsulochrin(1−) (CHEBI:58760) is conjugate base of demethylsulochrin (CHEBI:48948) |
| IUPAC Name |
|---|
| 2-(2,6-dihydroxy-4-methylbenzoyl)-5-hydroxy-3-methoxybenzoic acid |
| Synonym | Source |
|---|---|
| desmethylsulochrin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2707761 | Beilstein |
| CAS:59092-92-1 | NIST Chemistry WebBook |