EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27BrFNO2 |
| Net Charge | 0 |
| Average Mass | 448.376 |
| Monoisotopic Mass | 447.12092 |
| SMILES | C=CCN(C)CCCCCCOc1ccc(C(=O)c2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C23H27BrFNO2/c1-3-14-26(2)15-6-4-5-7-16-28-20-12-13-21(22(25)17-20)23(27)18-8-10-19(24)11-9-18/h3,8-13,17H,1,4-7,14-16H2,2H3 |
| InChIKey | CMYCCJYVZIMDFU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 5.4.99.7 (lanosterol synthase) inhibitor An EC 5.4.99.* (intramolecular transferase transferring other groups) inhibitor that interferes with the action of lanosterol synthase (EC 5.4.99.7). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ro 48-8071 (CHEBI:101064) has functional parent benzophenone (CHEBI:41308) |
| Ro 48-8071 (CHEBI:101064) has role antineoplastic agent (CHEBI:35610) |
| Ro 48-8071 (CHEBI:101064) has role EC 5.4.99.7 (lanosterol synthase) inhibitor (CHEBI:101086) |
| Ro 48-8071 (CHEBI:101064) is a aromatic ether (CHEBI:35618) |
| Ro 48-8071 (CHEBI:101064) is a aromatic ketone (CHEBI:76224) |
| Ro 48-8071 (CHEBI:101064) is a bromobenzenes (CHEBI:37149) |
| Ro 48-8071 (CHEBI:101064) is a monofluorobenzenes (CHEBI:83575) |
| Ro 48-8071 (CHEBI:101064) is a olefinic compound (CHEBI:78840) |
| Ro 48-8071 (CHEBI:101064) is a tertiary amino compound (CHEBI:50996) |
| Ro 48-8071 (CHEBI:101064) is conjugate base of Ro 48-8071(1+) (CHEBI:101224) |
| Incoming Relation(s) |
| Ro 48-8071(1+) (CHEBI:101224) is conjugate acid of Ro 48-8071 (CHEBI:101064) |
| IUPAC Name |
|---|
| (4-bromophenyl)[2-fluoro-4-({6-[methyl(prop-2-en-1-yl)amino]hexyl}oxy)phenyl]methanone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9437469 | Reaxys |
| CAS:161582-11-2 | ChemIDplus |
| Citations |
|---|