EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21ClO4 |
| Net Charge | 0 |
| Average Mass | 360.837 |
| Monoisotopic Mass | 360.11284 |
| SMILES | CC(C)OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H21ClO4/c1-13(2)24-19(23)20(3,4)25-17-11-7-15(8-12-17)18(22)14-5-9-16(21)10-6-14/h5-13H,1-4H3 |
| InChIKey | YMTINGFKWWXKFG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenofibrate (CHEBI:5001) has functional parent benzophenone (CHEBI:41308) |
| fenofibrate (CHEBI:5001) has role antilipemic drug (CHEBI:35679) |
| fenofibrate (CHEBI:5001) has role environmental contaminant (CHEBI:78298) |
| fenofibrate (CHEBI:5001) has role geroprotector (CHEBI:176497) |
| fenofibrate (CHEBI:5001) has role xenobiotic (CHEBI:35703) |
| fenofibrate (CHEBI:5001) is a aromatic ether (CHEBI:35618) |
| fenofibrate (CHEBI:5001) is a chlorobenzophenone (CHEBI:23135) |
| fenofibrate (CHEBI:5001) is a isopropyl ester (CHEBI:35725) |
| fenofibrate (CHEBI:5001) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| Synonyms | Source |
|---|---|
| Fenofibrate | KEGG COMPOUND |
| Procetofen | ChemIDplus |
| Isopropyl 2-(4-(4-chlorobenzoyl)phenoxy)-2-methylpropionate | ChemIDplus |
| Isopropyl (4'-(p-chlorobenzoyl)-2-phenoxy-2-methyl)propionate | ChemIDplus |
| 2-(4-(4-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid 1-methylethyl ester | ChemIDplus |
| FNF | DrugBank |
| Brand Names | Source |
|---|---|
| Tricor | KEGG DRUG |
| Lipantil | KEGG DRUG |
| Antara | DrugBank |
| Lipofen | KEGG DRUG |
| Triglide | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| C07586 | KEGG COMPOUND |
| D00565 | KEGG DRUG |
| DB01039 | DrugBank |
| DE2250327 | Patent |
| US4058552 | Patent |
| Fenofibrate | Wikipedia |
| HMDB0015173 | HMDB |
| LSM-3107 | LINCS |
| 1152 | DrugCentral |
| 3222 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2062462 | Reaxys |
| CAS:49562-28-9 | NIST Chemistry WebBook |
| CAS:49562-28-9 | ChemIDplus |
| Citations |
|---|