EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:5001 - fenofibrate
| Formula | C20H21ClO4 |
| Net Charge | 0 |
| Average Mass | 360.837 |
| Monoisotopic Mass | 360.11284 |
| SMILES | CC(C)OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H21ClO4/c1-13(2)24-19(23)20(3,4)25-17-11-7-15(8-12-17)18(22)14-5-9-16(21)10-6-14/h5-13H,1-4H3 |
| InChIKey | YMTINGFKWWXKFG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticholesteremic drug A substance used to lower plasma cholesterol levels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. hypoglycemic agent A drug which lowers the blood glucose level. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenofibrate (CHEBI:5001) has functional parent benzophenone (CHEBI:41308) |
| fenofibrate (CHEBI:5001) has role anti-HIV agent (CHEBI:64946) |
| fenofibrate (CHEBI:5001) has role anti-inflammatory agent (CHEBI:67079) |
| fenofibrate (CHEBI:5001) has role anti-obesity agent (CHEBI:74518) |
| fenofibrate (CHEBI:5001) has role antiatherosclerotic agent (CHEBI:145947) |
| fenofibrate (CHEBI:5001) has role anticholesteremic drug (CHEBI:35821) |
| fenofibrate (CHEBI:5001) has role antihypertensive agent (CHEBI:35674) |
| fenofibrate (CHEBI:5001) has role antilipemic drug (CHEBI:35679) |
| fenofibrate (CHEBI:5001) has role antineoplastic agent (CHEBI:35610) |
| fenofibrate (CHEBI:5001) has role cardiovascular drug (CHEBI:35554) |
| fenofibrate (CHEBI:5001) has role environmental contaminant (CHEBI:78298) |
| fenofibrate (CHEBI:5001) has role geroprotector (CHEBI:176497) |
| fenofibrate (CHEBI:5001) has role hypoglycemic agent (CHEBI:35526) |
| fenofibrate (CHEBI:5001) has role xenobiotic (CHEBI:35703) |
| fenofibrate (CHEBI:5001) is a aromatic ether (CHEBI:35618) |
| fenofibrate (CHEBI:5001) is a chlorobenzophenone (CHEBI:23135) |
| fenofibrate (CHEBI:5001) is a isopropyl ester (CHEBI:35725) |
| fenofibrate (CHEBI:5001) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| INN | Source |
|---|---|
| fenofibrato | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(4-(4-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid 1-methylethyl ester | ChemIDplus |
| Fenofibrate | KEGG COMPOUND |
| Fenofibrate delayed release | ChEMBL |
| Fenofibrate micronized | ChEMBL |
| Finofibrate | DrugBank |
| FNF | DrugBank |
| Brand Names | Source |
|---|---|
| Antara | DrugBank |
| Antara (micronized) | ChEMBL |
| Fenofibrate (micronized) | ChEMBL |
| Fenogal | ChEMBL |
| Fenoglide | ChEMBL |
| Lipantil | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1152 | DrugCentral |
| 3222 | ChemSpider |
| C07586 | KEGG COMPOUND |
| D00565 | KEGG DRUG |
| DB01039 | DrugBank |
| DE2250327 | Patent |
| Fenofibrate | Wikipedia |
| HMDB0015173 | HMDB |
| LSM-3107 | LINCS |
| US4058552 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2062462 | Reaxys |
| CAS:49562-28-9 | ChemIDplus |
| CAS:49562-28-9 | NIST Chemistry WebBook |
| Citations |
|---|