EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:5001 - fenofibrate
| Formula | C20H21ClO4 |
| Net Charge | 0 |
| Average Mass | 360.837 |
| Monoisotopic Mass | 360.11284 |
| SMILES | CC(C)OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H21ClO4/c1-13(2)24-19(23)20(3,4)25-17-11-7-15(8-12-17)18(22)14-5-9-16(21)10-6-14/h5-13H,1-4H3 |
| InChIKey | YMTINGFKWWXKFG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-inflammatory agent Any compound that has anti-inflammatory effects. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenofibrate (CHEBI:5001) has functional parent benzophenone (CHEBI:41308) |
| fenofibrate (CHEBI:5001) has role anti-HIV agent (CHEBI:64946) |
| fenofibrate (CHEBI:5001) has role anti-inflammatory agent (CHEBI:67079) |
| fenofibrate (CHEBI:5001) has role anti-obesity agent (CHEBI:74518) |
| fenofibrate (CHEBI:5001) has role antiatherosclerotic agent (CHEBI:145947) |
| fenofibrate (CHEBI:5001) has role anticholesteremic drug (CHEBI:35821) |
| fenofibrate (CHEBI:5001) has role antihypertensive agent (CHEBI:35674) |
| fenofibrate (CHEBI:5001) has role antilipemic drug (CHEBI:35679) |
| fenofibrate (CHEBI:5001) has role antineoplastic agent (CHEBI:35610) |
| fenofibrate (CHEBI:5001) has role cardiovascular drug (CHEBI:35554) |
| fenofibrate (CHEBI:5001) has role environmental contaminant (CHEBI:78298) |
| fenofibrate (CHEBI:5001) has role geroprotector (CHEBI:176497) |
| fenofibrate (CHEBI:5001) has role hypoglycemic agent (CHEBI:35526) |
| fenofibrate (CHEBI:5001) has role xenobiotic (CHEBI:35703) |
| fenofibrate (CHEBI:5001) is a aromatic ether (CHEBI:35618) |
| fenofibrate (CHEBI:5001) is a chlorobenzophenone (CHEBI:23135) |
| fenofibrate (CHEBI:5001) is a isopropyl ester (CHEBI:35725) |
| fenofibrate (CHEBI:5001) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| propan-2-yl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| INN | Source |
|---|---|
| fenofibrato | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-(4-(4-Chlorobenzoyl)phenoxy)-2-methylpropanoic acid 1-methylethyl ester | ChemIDplus |
| Fenofibrate | KEGG COMPOUND |
| Fenofibrate delayed release | ChEMBL |
| Fenofibrate micronized | ChEMBL |
| Finofibrate | DrugBank |
| FNF | DrugBank |
| Brand Names | Source |
|---|---|
| Antara | DrugBank |
| Antara (micronized) | ChEMBL |
| Fenofibrate (micronized) | ChEMBL |
| Fenogal | ChEMBL |
| Fenoglide | ChEMBL |
| Lipantil | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1152 | DrugCentral |
| 3222 | ChemSpider |
| C07586 | KEGG COMPOUND |
| D00565 | KEGG DRUG |
| DB01039 | DrugBank |
| DE2250327 | Patent |
| Fenofibrate | Wikipedia |
| HMDB0015173 | HMDB |
| LSM-3107 | LINCS |
| US4058552 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2062462 | Reaxys |
| CAS:49562-28-9 | ChemIDplus |
| CAS:49562-28-9 | NIST Chemistry WebBook |
| Citations |
|---|