EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13NO7S |
| Net Charge | 0 |
| Average Mass | 339.325 |
| Monoisotopic Mass | 339.04127 |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13NO7S/c1-23(21,22)8-5-6-9(10(7-8)15(19)20)14(18)13-11(16)3-2-4-12(13)17/h5-7,13H,2-4H2,1H3 |
| InChIKey | KPUREKXXPHOJQT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesotrione (CHEBI:38321) has functional parent benzophenone (CHEBI:41308) |
| mesotrione (CHEBI:38321) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| mesotrione (CHEBI:38321) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| mesotrione (CHEBI:38321) has role environmental contaminant (CHEBI:78298) |
| mesotrione (CHEBI:38321) has role herbicide (CHEBI:24527) |
| mesotrione (CHEBI:38321) has role xenobiotic (CHEBI:35703) |
| mesotrione (CHEBI:38321) is a C-nitro compound (CHEBI:35716) |
| mesotrione (CHEBI:38321) is a aromatic ketone (CHEBI:76224) |
| mesotrione (CHEBI:38321) is a sulfone (CHEBI:35850) |
| mesotrione (CHEBI:38321) is a β-triketone (CHEBI:140323) |
| Incoming Relation(s) |
| nitisinone (CHEBI:50378) is a mesotrione (CHEBI:38321) |
| IUPAC Name |
|---|
| 2-[4-(methanesulfonyl)-2-nitrobenzoyl]cyclohexane-1,3-dione |
| Synonyms | Source |
|---|---|
| 2-(2'-nitro-4'-methylsulfonylbenzoyl)cyclohexane-1,3-dione | ChEBI |
| 2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione | ChEBI |
| 2-(4-methylsulphonyl-2-nitrobenzoyl)-1,3-cyclohexanedione | ChEBI |
| (2-nitro-4-(methylsullfonyl))benzoylcyclohexane-1,3-dione | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tenacity | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 442 | PPDB |
| mesotrione | Alan Wood's Pesticides |
| Mesotrione | Wikipedia |
| WO2011016018 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8999656 | Reaxys |
| CAS:104206-82-8 | ChemIDplus |
| Citations |
|---|