EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2 |
| Net Charge | 0 |
| Average Mass | 89.094 |
| Monoisotopic Mass | 89.04768 |
| SMILES | NCCC(=O)O |
| InChI | InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
| InChIKey | UCMIRNVEIXFBKS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fundamental metabolite Any metabolite produced by all living cells. neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. agonist Substance which binds to cell receptors normally responding to naturally occurring substances and which produces a response of its own. inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-alanine (CHEBI:16958) has role agonist (CHEBI:48705) |
| β-alanine (CHEBI:16958) has role fundamental metabolite (CHEBI:78675) |
| β-alanine (CHEBI:16958) has role human metabolite (CHEBI:77746) |
| β-alanine (CHEBI:16958) has role inhibitor (CHEBI:35222) |
| β-alanine (CHEBI:16958) has role neurotransmitter (CHEBI:25512) |
| β-alanine (CHEBI:16958) is a β-amino acid (CHEBI:33706) |
| β-alanine (CHEBI:16958) is conjugate acid of β-alaninate (CHEBI:63070) |
| β-alanine (CHEBI:16958) is tautomer of β-alanine zwitterion (CHEBI:57966) |
| Incoming Relation(s) |
| N-(2-hydroxyethyl)-β-alanine (CHEBI:141390) has functional parent β-alanine (CHEBI:16958) |
| N-[4-(1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-ylcarbonyl)benzoyl]-β-alanine (CHEBI:71526) has functional parent β-alanine (CHEBI:16958) |
| N-methyl-β-alanine (CHEBI:138669) has functional parent β-alanine (CHEBI:16958) |
| β-alanine derivative (CHEBI:22823) has functional parent β-alanine (CHEBI:16958) |
| β-alanyl-CoA (CHEBI:15507) has functional parent β-alanine (CHEBI:16958) |
| β-alaninate (CHEBI:63070) is conjugate base of β-alanine (CHEBI:16958) |
| β-alanine zwitterion (CHEBI:57966) is tautomer of β-alanine (CHEBI:16958) |
| IUPAC Names |
|---|
| 3-aminopropanoic acid |
| β-alanine |
| Synonyms | Source |
|---|---|
| 3-aminopropanoic acid | ChEBI |
| 3-Aminopropionic acid | KEGG COMPOUND |
| bAla | ChEBI |
| beta-Alanine | KEGG COMPOUND |
| BETA-ALANINE | PDBeChem |
| H-β-Ala-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| BAL | PDBeChem |
| B-ALANINE | MetaCyc |
| Beta-Alanine | Wikipedia |
| C00001333 | KNApSAcK |
| C00099 | KEGG COMPOUND |
| D07561 | KEGG DRUG |
| DB03107 | DrugBank |
| HMDB0000056 | HMDB |
| Citations |
|---|