EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO2 |
| Net Charge | -1 |
| Average Mass | 88.086 |
| Monoisotopic Mass | 88.04040 |
| SMILES | NCCC(=O)[O-] |
| InChI | InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)/p-1 |
| InChIKey | UCMIRNVEIXFBKS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-alaninate (CHEBI:63070) has role fundamental metabolite (CHEBI:78675) |
| β-alaninate (CHEBI:63070) is a β-amino-acid anion (CHEBI:49095) |
| β-alaninate (CHEBI:63070) is conjugate base of β-alanine (CHEBI:16958) |
| Incoming Relation(s) |
| β-alanine (CHEBI:16958) is conjugate acid of β-alaninate (CHEBI:63070) |
| IUPAC Name |
|---|
| 3-aminopropanoate |
| Synonyms | Source |
|---|---|
| β-alaninate(1−) | ChEBI |
| β-alaninate anion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3536336 | Reaxys |