EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2 |
| Net Charge | 0 |
| Average Mass | 89.094 |
| Monoisotopic Mass | 89.04768 |
| SMILES | [NH3+]CCC(=O)[O-] |
| InChI | InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
| InChIKey | UCMIRNVEIXFBKS-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-alanine zwitterion (CHEBI:57966) is a amino-acid zwitterion (CHEBI:35238) |
| β-alanine zwitterion (CHEBI:57966) is tautomer of β-alanine (CHEBI:16958) |
| Incoming Relation(s) |
| β-alanyl-5'-AMP zwitterion (CHEBI:192795) has functional parent β-alanine zwitterion (CHEBI:57966) |
| β-alanine (CHEBI:16958) is tautomer of β-alanine zwitterion (CHEBI:57966) |
| IUPAC Name |
|---|
| 3-azaniumylpropanoate |
| Synonym | Source |
|---|---|
| 3-ammoniopropanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| β-alanine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:454332 | Gmelin |