EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O3 |
| Net Charge | 0 |
| Average Mass | 224.260 |
| Monoisotopic Mass | 224.11609 |
| SMILES | NCCC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H16N2O3/c12-5-3-11(16)13-6-4-8-1-2-9(14)10(15)7-8/h1-2,7,14-15H,3-6,12H2,(H,13,16) |
| InChIKey | KGZWXTYWZFMLSQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N‐β‐alanyldopamine (CHEBI:125666) has functional parent dopamine (CHEBI:18243) |
| N‐β‐alanyldopamine (CHEBI:125666) has functional parent β-alanine (CHEBI:16958) |
| N‐β‐alanyldopamine (CHEBI:125666) is a catecholamine (CHEBI:33567) |
| N‐β‐alanyldopamine (CHEBI:125666) is a primary amino compound (CHEBI:50994) |
| N‐β‐alanyldopamine (CHEBI:125666) is a secondary carboxamide (CHEBI:140325) |
| N‐β‐alanyldopamine (CHEBI:125666) is conjugate base of N‐β‐alanyldopamine(1+) (CHEBI:192799) |
| Incoming Relation(s) |
| N‐β‐alanyldopamine(1+) (CHEBI:192799) is conjugate acid of N‐β‐alanyldopamine (CHEBI:125666) |
| IUPAC Name |
|---|
| N-[2-(3,4-dihydroxyphenyl)ethyl]-β-alaninamide |
| Synonyms | Source |
|---|---|
| 3-amino-N-[2-(3,4-dihydroxyphenyl)ethyl]propanamide | IUPAC |
| N(β)-alanyldopamine | PubChem Compound |
| N-β-alanyl dopamine | ChEBI |
| NBAD | ChEBI |
| N-β-alanyl-dopamine | ChEBI |
| β-alanyl-dopamine | PubChem Compound |
| Citations |
|---|