EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CNCCC(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-5-3-2-4(6)7/h5H,2-3H2,1H3,(H,6,7) |
| InChIKey | VDIPNVCWMXZNFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-β-alanine (CHEBI:138669) has functional parent β-alanine (CHEBI:16958) |
| N-methyl-β-alanine (CHEBI:138669) is a secondary amino compound (CHEBI:50995) |
| N-methyl-β-alanine (CHEBI:138669) is a β-amino acid (CHEBI:33706) |
| Incoming Relation(s) |
| N,N-dimethyl-β-alanine (CHEBI:138668) has functional parent N-methyl-β-alanine (CHEBI:138669) |
| IUPAC Name |
|---|
| N-methyl-β-alanine |
| Synonyms | Source |
|---|---|
| 3-methylaminopropanoic acid | ChEBI |
| 3-(methylamino)propanoic acid | IUPAC |
| 3-methylaminopropionic acid | ChEBI |
| 3-(methylamino)propionic acid | IUPAC |
| Citations |
|---|