EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H41N8O17P3S |
| Net Charge | 0 |
| Average Mass | 838.620 |
| Monoisotopic Mass | 838.15232 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)CCN |
| InChI | InChI=1S/C24H41N8O17P3S/c1-24(2,19(36)22(37)28-6-4-14(33)27-7-8-53-15(34)3-5-25)10-46-52(43,44)49-51(41,42)45-9-13-18(48-50(38,39)40)17(35)23(47-13)32-12-31-16-20(26)29-11-30-21(16)32/h11-13,17-19,23,35-36H,3-10,25H2,1-2H3,(H,27,33)(H,28,37)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t13-,17-,18-,19+,23-/m1/s1 |
| InChIKey | RUWSXZUPLIXLGD-IEXPHMLFSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-alanyl-CoA (CHEBI:15507) has functional parent β-alanine (CHEBI:16958) |
| β-alanyl-CoA (CHEBI:15507) is a acyl-CoA (CHEBI:17984) |
| β-alanyl-CoA (CHEBI:15507) is conjugate acid of β-alanyl-CoA(3−) (CHEBI:57362) |
| Incoming Relation(s) |
| β-alanyl-CoA(3−) (CHEBI:57362) is conjugate base of β-alanyl-CoA (CHEBI:15507) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(3-aminopropanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-aminopropionyl-CoA | ChEBI |
| 3-aminopropionyl-coenzyme A | ChEBI |
| beta-alanyl-CoA | ChEBI |
| beta-Alanyl-CoA | KEGG COMPOUND |
| S-β-Ala-CoA | ChEBI |
| S-β-alanyl-CoA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02335 | KEGG COMPOUND |
| C02335 | KEGG COMPOUND |
| HMDB0006805 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78295 | Reaxys |
| Citations |
|---|