EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2122A-1b_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6+/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-QIUUJYRFSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | PubMed (20117838 ) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-glucuronic acid (CHEBI:28860) has role metabolite (CHEBI:25212) |
| β-D-glucuronic acid (CHEBI:28860) is a D-glucopyranuronic acid (CHEBI:47952) |
| β-D-glucuronic acid (CHEBI:28860) is conjugate acid of β-D-glucuronate (CHEBI:85313) |
| Incoming Relation(s) |
| 2-Me-α-D-Fucp4NAc-(1→4)-β-D-GlcpA (CHEBI:59383) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| 3-indole carboxylic acid glucuronide (CHEBI:68486) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| 5-(3',5'-dihydroxyphenyl)-valeric acid-O-glucuronide (CHEBI:149595) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| 5α-androstane-3β,17β-diol 3-O-(β-D-glucuronide) (CHEBI:88730) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| acetaminophen O-β-D-glucosiduronic acid (CHEBI:32636) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| atractyligenin 2-glucuronide (CHEBI:196976) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| cytosylglucuronic acid (CHEBI:132133) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| dehydroisoandrosterone 3-glucuronide (CHEBI:68834) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| kaempferol O-glucuronide (CHEBI:75720) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| luteolin O-glucuronoside (CHEBI:25091) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| methyl β-D-glucopyranuronate (CHEBI:145605) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| methyl β-D-glucuronoside (CHEBI:53688) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| mycophenolic acid O-acyl-glucuronide (CHEBI:64689) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| myricetin O-glucuronide (CHEBI:75806) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| octanoyl-β-D-glucuronide (CHEBI:71003) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| α-D-GlcpNAc-(1→4)-β-D-GlcpA (CHEBI:150151) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-GlcpA-(1→3)-β-D-GalpNAc4S (CHEBI:145591) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-GlcpA-(1→3)-β-D-GalpNAc6S (CHEBI:145588) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-GlcpA-(1→4)-D-Xylp (CHEBI:150112) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-GlcpNAc-(1→4)-β-D-GlcpA (CHEBI:150712) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-glucuronamide (CHEBI:32323) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-Xylp-(1→3)-β-D-GlcpA (CHEBI:149024) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-Xylp-(1→4)-β-D-GlcpA (CHEBI:151572) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| β-D-glucuronate (CHEBI:85313) is conjugate base of β-D-glucuronic acid (CHEBI:28860) |
| IUPAC Names |
|---|
| (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxytetrahydro-2H-pyran-2-carboxylic acid |
| β-D-glucopyranuronic acid |
| Synonyms | Source |
|---|---|
| beta-D-Glucopyranuronic acid | KEGG COMPOUND |
| beta-D-Glucuronic acid | KEGG COMPOUND |
| GlcAb | ChEBI |
| GlcAβ | ChEBI |
| β-D-GlcpA | IUPAC |
| β-D-glucopyranuronic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| BDP | PDBeChem |
| C00001123 | KNApSAcK |
| C08350 | KEGG COMPOUND |
| CPD-12521 | MetaCyc |
| Glucuronic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1427744 | Reaxys |
| Gmelin:2497864 | Gmelin |
| Citations |
|---|