EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N3O7 |
| Net Charge | 0 |
| Average Mass | 287.228 |
| Monoisotopic Mass | 287.07535 |
| SMILES | Nc1ccn([C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C10H13N3O7/c11-3-1-2-13(10(19)12-3)8-6(16)4(14)5(15)7(20-8)9(17)18/h1-2,4-8,14-16H,(H,17,18)(H2,11,12,19)/t4-,5-,6+,7-,8+/m0/s1 |
| InChIKey | CHKIQPXDGYGCHW-YOWKYNACSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseochromogenes (ncbitaxon:68214) | - | PubMed (23377931) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytosylglucuronic acid (CHEBI:132133) has functional parent cytosine (CHEBI:16040) |
| cytosylglucuronic acid (CHEBI:132133) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| cytosylglucuronic acid (CHEBI:132133) has role bacterial metabolite (CHEBI:76969) |
| cytosylglucuronic acid (CHEBI:132133) is a N-glycosyl compound (CHEBI:21731) |
| cytosylglucuronic acid (CHEBI:132133) is a carbohydrate acid derivative (CHEBI:63436) |
| cytosylglucuronic acid (CHEBI:132133) is a monosaccharide derivative (CHEBI:63367) |
| cytosylglucuronic acid (CHEBI:132133) is a nucleobase-containing molecular entity (CHEBI:61120) |
| cytosylglucuronic acid (CHEBI:132133) is conjugate acid of cytosylglucuronate (CHEBI:132252) |
| Incoming Relation(s) |
| cytosylglucuronate (CHEBI:132252) is conjugate base of cytosylglucuronic acid (CHEBI:132133) |
| IUPAC Name |
|---|
| 4-amino-1-β-D-glucopyranuronosylpyrimidin-2(1H)-one |
| Synonyms | Source |
|---|---|
| Pentopyranic acid | ChemIDplus |
| 1-(beta-D-Glucopyranosyluronic acid)cytosine | ChemIDplus |
| cytosyl-β-D-glucuronic acid | ChEBI |
| 1-(β-D-glucuronosyl)cytosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17160 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:834916 | Reaxys |
| CAS:59862-05-4 | ChemIDplus |
| Citations |
|---|