EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2122A-1x_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3+,4-,6?/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-AQKNRBDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucopyranuronic acid (CHEBI:47952) has role algal metabolite (CHEBI:84735) |
| D-glucopyranuronic acid (CHEBI:47952) is a D-glucuronic acid (CHEBI:4178) |
| D-glucopyranuronic acid (CHEBI:47952) is conjugate acid of D-glucopyranuronate (CHEBI:58720) |
| D-glucopyranuronic acid (CHEBI:47952) is enantiomer of L-glucopyranuronic acid (CHEBI:79049) |
| Incoming Relation(s) |
| [4)-β-D-GlcpA-(1→4)-α-D-GlcpNAc-(1→]n (CHEBI:62819) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| [4)-β-D-GlcpA-(1→4)-α-D-GlcpNAc6OS-(1→]n (CHEBI:62820) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| [4)-β-D-GlcpA-(1→4)-α-D-GlcpNS6OS-(1→]n (CHEBI:62821) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| 1-O-(α-D-glucopyranuronosyl)-N-tetradecanoyldihydrosphingosine (CHEBI:60476) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| 4-O-methyl-α-D-glucuronoside ester (CHEBI:171667) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| glycosylglucopyranuronic acid (CHEBI:152563) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| heparosan D-glucuronic acid (CHEBI:85801) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| UDP-D-glucuronic acid (CHEBI:197331) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| β-D-Xylp-(1→2)-D-GlcpA (CHEBI:151701) has functional parent D-glucopyranuronic acid (CHEBI:47952) |
| heparosan-N-sulfate D-glucuronic acid (CHEBI:17831) is a D-glucopyranuronic acid (CHEBI:47952) |
| α-D-glucuronic acid (CHEBI:42717) is a D-glucopyranuronic acid (CHEBI:47952) |
| β-D-glucuronic acid (CHEBI:28860) is a D-glucopyranuronic acid (CHEBI:47952) |
| D-glucopyranuronate (CHEBI:58720) is conjugate base of D-glucopyranuronic acid (CHEBI:47952) |
| L-glucopyranuronic acid (CHEBI:79049) is enantiomer of D-glucopyranuronic acid (CHEBI:47952) |
| IUPAC Name |
|---|
| D-glucopyranuronic acid |
| Synonyms | Source |
|---|---|
| Glucuronate | KEGG COMPOUND |
| Glucuronic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001123 | KNApSAcK |
| C00191 | KEGG COMPOUND |
| DB03156 | DrugBank |
| D-Glucopyranuronate | MetaCyc |
| ECMDB04073 | ECMDB |
| HMDB0000127 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1427741 | Reaxys |
| Gmelin:397418 | Gmelin |
| CAS:528-16-5 | ChemIDplus |
| CAS:6556-12-3 | KEGG COMPOUND |
| Citations |
|---|