EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O8 |
| Net Charge | 0 |
| Average Mass | 466.571 |
| Monoisotopic Mass | 466.25667 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@@H](O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C25H38O8/c1-24-9-7-13(32-23-20(29)18(27)19(28)21(33-23)22(30)31)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-16,18-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/t12-,13+,14-,15-,16-,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | VFUIRAVTUVCQTF-BSOWLZGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has functional parent androsterone (CHEBI:16032) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has role human metabolite (CHEBI:77746) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has role metabolite (CHEBI:25212) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has role mouse metabolite (CHEBI:75771) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) is a steroid glucosiduronic acid (CHEBI:26763) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) is a β-D-glucosiduronic acid (CHEBI:15341) |
| IUPAC Name |
|---|
| (3α,5α)-17-oxoandrostan-3-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 3α-hydroxy-5α-androstan-17-one glucuronide | HMDB |
| Androsterone 3-glucuronide | KEGG COMPOUND |
| Androsterone glucosiduronate | ChemIDplus |
| Androsterone glucuronide | KEGG COMPOUND |
| androsterone glucuronoside | ChEBI |
| Etiocholanolone glucuronide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11135 | KEGG COMPOUND |
| HMDB0002829 | HMDB |
| LMST05010013 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:64682 | Reaxys |
| CAS:1852-43-3 | ChemIDplus |
| CAS:1852-43-3 | KEGG COMPOUND |
| Citations |
|---|