EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O8 |
| Net Charge | 0 |
| Average Mass | 466.571 |
| Monoisotopic Mass | 466.25667 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@@H](O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C25H38O8/c1-24-9-7-13(32-23-20(29)18(27)19(28)21(33-23)22(30)31)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-16,18-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/t12-,13+,14-,15-,16-,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | VFUIRAVTUVCQTF-BSOWLZGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has functional parent androsterone (CHEBI:16032) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has role human metabolite (CHEBI:77746) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has role metabolite (CHEBI:25212) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) has role mouse metabolite (CHEBI:75771) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) is a steroid glucosiduronic acid (CHEBI:26763) |
| androsterone 3-glucosiduronic acid (CHEBI:28832) is a β-D-glucosiduronic acid (CHEBI:15341) |
| IUPAC Name |
|---|
| (3α,5α)-17-oxoandrostan-3-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| Androsterone glucuronide | KEGG COMPOUND |
| Androsterone 3-glucuronide | KEGG COMPOUND |
| androsterone glucuronoside | ChEBI |
| Androsterone glucosiduronate | ChemIDplus |
| Etiocholanolone glucuronide | ChemIDplus |
| 3α-hydroxy-5α-androstan-17-one glucuronide | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C11135 | KEGG COMPOUND |
| LMST05010013 | LIPID MAPS |
| HMDB0002829 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:64682 | Reaxys |
| CAS:1852-43-3 | KEGG COMPOUND |
| CAS:1852-43-3 | ChemIDplus |
| Citations |
|---|