EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O7 |
| Net Charge | 0 |
| Average Mass | 208.166 |
| Monoisotopic Mass | 208.05830 |
| SMILES | CO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2122A-1b_1-5_1*OC]/1/ |
| InChI | InChI=1S/C7H12O7/c1-13-7-4(10)2(8)3(9)5(14-7)6(11)12/h2-5,7-10H,1H3,(H,11,12)/t2-,3-,4+,5-,7+/m0/s1 |
| InChIKey | BOFXVYGDIRCHEQ-GHQVIJFQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl β-D-glucuronoside (CHEBI:53688) has functional parent β-D-glucuronic acid (CHEBI:28860) |
| methyl β-D-glucuronoside (CHEBI:53688) is a D-glucuronic acid (CHEBI:4178) |
| IUPAC Name |
|---|
| methyl β-D-glucuronoside |
| Synonyms | Source |
|---|---|
| O1-methyl-β-D-glucopyranuronic acid | ChEBI |
| Methyl-beta-D-glucopyranosiduronic acid | ChemIDplus |
| Methyl beta-glucuronide | ChemIDplus |
| Methylglucopyranosiduronic acid | ChemIDplus |
| methyl β-D-glucopyranosiduronic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:84757 | Reaxys |
| CAS:4356-84-7 | ChemIDplus |
| Citations |
|---|