EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O2 |
| Net Charge | 0 |
| Average Mass | 112.128 |
| Monoisotopic Mass | 112.05243 |
| SMILES | C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8)/b3-2+,5-4+ |
| InChIKey | WSWCOQWTEOXDQX-MQQKCMAXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) is a sorbic acid (CHEBI:35962) |
| (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) is conjugate acid of (E,E)-sorbate (CHEBI:77869) |
| Incoming Relation(s) |
| trans,trans-2,4-hexadienoyl-CoA (CHEBI:85439) has functional parent (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) |
| nigragillin (CHEBI:133753) has functional parent (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) |
| (E,E)-sorbate (CHEBI:77869) is conjugate base of (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) |
| IUPAC Name |
|---|
| (2E,4E)-hexa-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| (E,E)-2,4-hexadienoic acid | NIST Chemistry WebBook |
| (E,E)-sorbic acid | ChemIDplus |
| α-trans-γ-trans-sorbic acid | NIST Chemistry WebBook |
| trans,trans-2,4-hexadienoic acid | NIST Chemistry WebBook |
| (2E,4E)-2,4-hexadienoic acid | NIST Chemistry WebBook |
| trans,trans-sorbic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030100 | LIPID MAPS |
| Citations |
|---|