EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42N7O17P3S |
| Net Charge | 0 |
| Average Mass | 861.654 |
| Monoisotopic Mass | 861.15707 |
| SMILES | C/C=C/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C27H42N7O17P3S/c1-4-5-6-7-18(36)55-11-10-29-17(35)8-9-30-25(39)22(38)27(2,3)13-48-54(45,46)51-53(43,44)47-12-16-21(50-52(40,41)42)20(37)26(49-16)34-15-33-19-23(28)31-14-32-24(19)34/h4-7,14-16,20-22,26,37-38H,8-13H2,1-3H3,(H,29,35)(H,30,39)(H,43,44)(H,45,46)(H2,28,31,32)(H2,40,41,42)/b5-4+,7-6+/t16-,20-,21-,22+,26-/m1/s1 |
| InChIKey | OUDBPEVXTMAWSG-VUJIAKIYSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans,trans-2,4-hexadienoyl-CoA (CHEBI:85439) has functional parent (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) |
| trans,trans-2,4-hexadienoyl-CoA (CHEBI:85439) is a trans,trans-2,3,4,5-tetradehydroacyl-CoA (CHEBI:17157) |
| trans,trans-2,4-hexadienoyl-CoA (CHEBI:85439) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| trans,trans-2,4-hexadienoyl-CoA (CHEBI:85439) is conjugate acid of trans,trans-2,4-hexadienoyl-CoA(4−) (CHEBI:84788) |
| Incoming Relation(s) |
| trans,trans-2,4-hexadienoyl-CoA(4−) (CHEBI:84788) is conjugate base of trans,trans-2,4-hexadienoyl-CoA (CHEBI:85439) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(2E,4E)-hexa-2,4-dienoyl]sulfanyl}ethyl)amino]-3-hydroxy-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 2trans,4trans-hexadienoyl-CoA | ChEBI |
| (2E,4E)-hexadienoyl-CoA | ChEBI |
| trans,trans-2,4-hexadienoyl-coenzyme A | ChEBI |
| 2trans,4trans-hexadienoyl-coenzyme A | ChEBI |
| (2E,4E)-hexadienoyl-coenzyme A | ChEBI |
| (E,E)-2,4-hexadienoyl-coenzyme A | ChEBI |