EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O2 |
| Net Charge | -1 |
| Average Mass | 111.120 |
| Monoisotopic Mass | 111.04515 |
| SMILES | C/C=C/C=C/C(=O)[O-] |
| InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8)/p-1/b3-2+,5-4+ |
| InChIKey | WSWCOQWTEOXDQX-MQQKCMAXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E)-sorbate (CHEBI:77869) is a sorbate (CHEBI:36550) |
| (E,E)-sorbate (CHEBI:77869) is conjugate base of (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) |
| Incoming Relation(s) |
| potassium sorbate (CHEBI:77868) has part (E,E)-sorbate (CHEBI:77869) |
| (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) is conjugate acid of (E,E)-sorbate (CHEBI:77869) |
| IUPAC Name |
|---|
| (2E,4E)-hexa-2,4-dienoate |
| Synonyms | Source |
|---|---|
| (E,E)-2,4-hexadienoate | ChEBI |
| trans,trans-2,4-hexadienoate | ChEBI |
| trans,trans-sorbate | ChEBI |
| UniProt Name | Source |
|---|---|
| (E,E)-sorbate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4797560 | Reaxys |