EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N2O |
| Net Charge | 0 |
| Average Mass | 222.332 |
| Monoisotopic Mass | 222.17321 |
| SMILES | C/C=C/C=C/C(=O)N1C[C@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C13H22N2O/c1-5-6-7-8-13(16)15-10-11(2)14(4)9-12(15)3/h5-8,11-12H,9-10H2,1-4H3/b6-5+,8-7+/t11-,12+/m0/s1 |
| InChIKey | DVCNHRTYSUTLOS-OJRXFFSMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus awamori (ncbitaxon:105351) | - | PubMed (26669099) | |
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (21176790) | Strain: ATCC 11414 |
| Aspergillus vadensis (ncbitaxon:288669) | - | PubMed (15803385) | |
| Zephyranthes candida (ncbitaxon:82257) | whole plant (BTO:0001461) | PubMed (23190013) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigragillin (CHEBI:133753) has functional parent (2E,4E)-hexa-2,4-dienoic acid (CHEBI:38358) |
| nigragillin (CHEBI:133753) has role Aspergillus metabolite (CHEBI:76956) |
| nigragillin (CHEBI:133753) is a N-acylpiperazine (CHEBI:46844) |
| nigragillin (CHEBI:133753) is a N-alkylpiperazine (CHEBI:46845) |
| nigragillin (CHEBI:133753) is a alkaloid (CHEBI:22315) |
| nigragillin (CHEBI:133753) is a enamide (CHEBI:51751) |
| nigragillin (CHEBI:133753) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (2E,4E)-1-[(2R,5S)-2,4,5-trimethylpiperazin-1-yl]hexa-2,4-dien-1-one |
| Synonym | Source |
|---|---|
| Nigragilline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23183184 | Reaxys |
| CAS:24779-38-2 | ChemIDplus |
| Citations |
|---|