EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-23,31H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,23-,27-,28+,29+,30-/m0/s1 |
| InChIKey | MIJYXULNPSFWEK-GTOFXWBISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diospyros kaki (ncbitaxon:35925) | calyx (BTO:0000169) | PubMed (21561086) | |
| Juglans sinensis (ncbitaxon:442437-1) | |||
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Radermachera boniana (IPNI:110489-1) | |||
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| Rhododendron (ncbitaxon:4346) | - | PubMed (21443171) | |
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried,powdered leaves,ursolic & oleanolic acid mixture |
| Symplocos lancifolia (ncbitaxon:239704) | leaf (BTO:0000713) | PubMed (21288041) | Dried, powdered leaves extracted with boiling 80% methanol |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleanolic acid (CHEBI:37659) has parent hydride oleanane (CHEBI:36481) |
| oleanolic acid (CHEBI:37659) has role plant metabolite (CHEBI:76924) |
| oleanolic acid (CHEBI:37659) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| oleanolic acid (CHEBI:37659) is a pentacyclic triterpenoid (CHEBI:25872) |
| oleanolic acid (CHEBI:37659) is conjugate acid of oleanolate (CHEBI:82828) |
| Incoming Relation(s) |
| 3β,6β,23-trihydroxyolean-12-en-28-oic acid (CHEBI:69369) has functional parent oleanolic acid (CHEBI:37659) |
| 4-epihederagenin (CHEBI:69528) has functional parent oleanolic acid (CHEBI:37659) |
| acutoside A (CHEBI:65370) has functional parent oleanolic acid (CHEBI:37659) |
| gypsogenin (CHEBI:5580) has functional parent oleanolic acid (CHEBI:37659) |
| hederagenin (CHEBI:69579) has functional parent oleanolic acid (CHEBI:37659) |
| oleanolic acid 3-O-[O-β-D-glucopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→3)-O-α-L-rhamnopyranosyl-(1→2)-α-L-arabinopyranoside] (CHEBI:66818) has functional parent oleanolic acid (CHEBI:37659) |
| oleanolic acid 3-O-β-D-glucosiduronic acid (CHEBI:37658) has functional parent oleanolic acid (CHEBI:37659) |
| protobassic acid (CHEBI:73086) has functional parent oleanolic acid (CHEBI:37659) |
| spathodic acid (CHEBI:69529) has functional parent oleanolic acid (CHEBI:37659) |
| spinosic acid A (CHEBI:39212) has functional parent oleanolic acid (CHEBI:37659) |
| oleanolate (CHEBI:82828) is conjugate base of oleanolic acid (CHEBI:37659) |
| IUPAC Name |
|---|
| 3β-hydroxyolean-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| 3beta-Hydroxyolean-12-en-28-oic acid | KEGG COMPOUND |
| Astrantiagenin C | KEGG COMPOUND |
| Astrantiagenin C | ChemIDplus |
| Caryophyllin | ChemIDplus |
| Caryophyllin | KEGG COMPOUND |
| Giganteumgenin C | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C17148 | KEGG COMPOUND |
| Oleanolic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:508-02-1 | ChemIDplus |
| CAS:508-02-1 | KEGG COMPOUND |
| Citations |
|---|