EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@]1(C)CO |
| InChI | InChI=1S/C30H48O4/c1-25(2)13-15-30(24(33)34)16-14-28(5)19(20(30)17-25)7-8-22-26(3)11-10-23(32)27(4,18-31)21(26)9-12-29(22,28)6/h7,20-23,31-32H,8-18H2,1-6H3,(H,33,34)/t20-,21+,22+,23-,26-,27+,28+,29+,30-/m0/s1 |
| InChIKey | PGOYMURMZNDHNS-YGUUOLNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-epihederagenin (CHEBI:69528) has functional parent oleanolic acid (CHEBI:37659) |
| 4-epihederagenin (CHEBI:69528) has parent hydride oleanane (CHEBI:36481) |
| 4-epihederagenin (CHEBI:69528) has role plant metabolite (CHEBI:76924) |
| 4-epihederagenin (CHEBI:69528) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 4-epihederagenin (CHEBI:69528) is a pentacyclic triterpenoid (CHEBI:25872) |
| 4-epihederagenin (CHEBI:69528) is a sapogenin (CHEBI:26606) |
| IUPAC Name |
|---|
| 3β,24-dihydroxyolean-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2711856 | Reaxys |
| Citations |
|---|