EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)C=O |
| InChI | InChI=1S/C30H46O4/c1-25(2)13-15-30(24(33)34)16-14-28(5)19(20(30)17-25)7-8-22-26(3)11-10-23(32)27(4,18-31)21(26)9-12-29(22,28)6/h7,18,20-23,32H,8-17H2,1-6H3,(H,33,34)/t20-,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | QMHCWDVPABYZMC-MYPRUECHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gypsogenin (CHEBI:5580) has functional parent oleanolic acid (CHEBI:37659) |
| gypsogenin (CHEBI:5580) is a aldehyde (CHEBI:17478) |
| gypsogenin (CHEBI:5580) is a monocarboxylic acid (CHEBI:25384) |
| gypsogenin (CHEBI:5580) is a pentacyclic triterpenoid (CHEBI:25872) |
| gypsogenin (CHEBI:5580) is a sapogenin (CHEBI:26606) |
| gypsogenin (CHEBI:5580) is conjugate acid of gypsogenin(1−) (CHEBI:140467) |
| Incoming Relation(s) |
| gypsogenin 28-β-D-glucoside (CHEBI:167133) has functional parent gypsogenin (CHEBI:5580) |
| gypsogenin 3-O-rhamnosylglucosiduronic acid (CHEBI:46707) has functional parent gypsogenin (CHEBI:5580) |
| gypsosaponin B (CHEBI:65993) has functional parent gypsogenin (CHEBI:5580) |
| salzmannianoside A (CHEBI:66157) has functional parent gypsogenin (CHEBI:5580) |
| gypsogenin(1−) (CHEBI:140467) is conjugate base of gypsogenin (CHEBI:5580) |
| IUPAC Name |
|---|
| 3β-hydroxy-23-oxoolean-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| Albsapogenin | ChemIDplus |
| Astrantiagenin D | ChemIDplus |
| Githagenin | ChemIDplus |
| Gypsogenin | KEGG COMPOUND |
| Gypsophilasapogenin | ChemIDplus |
| Gypsophilasaponin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00003525 | KNApSAcK |
| C08950 | KEGG COMPOUND |
| CPD-9470 | MetaCyc |
| LMPR0106150010 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3228001 | Reaxys |
| CAS:639-14-5 | KEGG COMPOUND |
| CAS:639-14-5 | ChemIDplus |
| Citations |
|---|