EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O4/c1-25(2)13-15-30(24(33)34)16-14-28(5)19(20(30)17-25)7-8-22-26(3)11-10-23(32)27(4,18-31)21(26)9-12-29(22,28)6/h7,20-23,31-32H,8-18H2,1-6H3,(H,33,34)/t20-,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | PGOYMURMZNDHNS-MYPRUECHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kalopanax pictus (ncbitaxon:46399) | stem (BTO:0001300) | PubMed (21870831) | Previous component: stem bark; Hot MeOH extract of dried stem bark |
| Paeonia rockii subsp. rockii (ncbitaxon:459179) | root (BTO:0001188) | PubMed (21954959) | Isolated from chloroform soluble extract of air-dried and powdered roots |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hederagenin (CHEBI:69579) has functional parent oleanolic acid (CHEBI:37659) |
| hederagenin (CHEBI:69579) has parent hydride oleanane (CHEBI:36481) |
| hederagenin (CHEBI:69579) has role plant metabolite (CHEBI:76924) |
| hederagenin (CHEBI:69579) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| hederagenin (CHEBI:69579) is a pentacyclic triterpenoid (CHEBI:25872) |
| hederagenin (CHEBI:69579) is a sapogenin (CHEBI:26606) |
| hederagenin (CHEBI:69579) is conjugate acid of hederagenin(1−) (CHEBI:140466) |
| Incoming Relation(s) |
| 3-O-[2,3-di-O-acetyl-α-L-arabinopyranosyl]-hederagenin 28-O-α-L-rhamnopyranosyl-(1→4)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside (CHEBI:69366) has functional parent hederagenin (CHEBI:69579) |
| 3-O-[3,4-di-O-acetyl-α-L-arabinopyranosyl]hederagenin 28-O-α-L-rhamnopyranosyl-(1→4)-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside (CHEBI:69367) has functional parent hederagenin (CHEBI:69579) |
| akebia saponin D (CHEBI:194124) has functional parent hederagenin (CHEBI:69579) |
| cauloside D (CHEBI:69375) has functional parent hederagenin (CHEBI:69579) |
| dipsacussaponin A (CHEBI:69374) has functional parent hederagenin (CHEBI:69579) |
| hederagenin 28-O-β-D-glucopyranoside (CHEBI:67947) has functional parent hederagenin (CHEBI:69579) |
| hederagenin 3-O-arabinoside (CHEBI:5634) has functional parent hederagenin (CHEBI:69579) |
| kalopanaxsaponin A (CHEBI:69370) has functional parent hederagenin (CHEBI:69579) |
| kalopanaxsaponin B (CHEBI:69371) has functional parent hederagenin (CHEBI:69579) |
| kalopanaxsaponin C (CHEBI:69372) has functional parent hederagenin (CHEBI:69579) |
| salzmannianoside B (CHEBI:66158) has functional parent hederagenin (CHEBI:69579) |
| sieboldianoside A (CHEBI:69373) has functional parent hederagenin (CHEBI:69579) |
| hederagenin(1−) (CHEBI:140466) is conjugate base of hederagenin (CHEBI:69579) |
| IUPAC Name |
|---|
| (3β)-3,23-dihydroxyolean-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| Astrantiagenin E | ChemIDplus |
| Caulosapogenin | ChemIDplus |
| Hederagenic acid | ChemIDplus |
| Hederagenol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101564405 | Patent |
| CN102633857 | Patent |
| CN102697791 | Patent |
| CPD-9481 | MetaCyc |
| Hederagenin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2711855 | Reaxys |
| CAS:465-99-6 | ChemIDplus |
| Citations |
|---|