EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CCC(C)(C)[C@@H](O)[C@@]34[H])[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O)[C@]1(C)CO |
| InChI | InChI=1S/C30H48O5/c1-25(2)13-15-30(24(34)35)16-14-28(5)18(22(30)23(25)33)7-8-20-26(3)11-10-21(32)27(4,17-31)19(26)9-12-29(20,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20-,21+,22-,23+,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | TUOYZAJHBIXONX-CGSJAQJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spathodic acid (CHEBI:69529) has functional parent oleanolic acid (CHEBI:37659) |
| spathodic acid (CHEBI:69529) has parent hydride oleanane (CHEBI:36481) |
| spathodic acid (CHEBI:69529) has role plant metabolite (CHEBI:76924) |
| spathodic acid (CHEBI:69529) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| spathodic acid (CHEBI:69529) is a pentacyclic triterpenoid (CHEBI:25872) |
| spathodic acid (CHEBI:69529) is a sapogenin (CHEBI:26606) |
| IUPAC Name |
|---|
| 3β,19α,24-trihydroxyolean-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4277617 | Reaxys |
| Citations |
|---|