EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3O4 |
| Net Charge | -1 |
| Average Mass | 115.064 |
| Monoisotopic Mass | 115.00368 |
| SMILES | [H]C(C(=O)[O-])=C([H])C(=O)O |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-1 |
| InChIKey | VZCYOOQTPOCHFL-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydrogen butenedioate (CHEBI:37155) is a dicarboxylic acid monoanion (CHEBI:35695) |
| hydrogen butenedioate (CHEBI:37155) is conjugate acid of butenedioate (CHEBI:36180) |
| hydrogen butenedioate (CHEBI:37155) is conjugate base of butenedioic acid (CHEBI:22958) |
| Incoming Relation(s) |
| fumarate(1−) (CHEBI:37154) is a hydrogen butenedioate (CHEBI:37155) |
| maleate(1−) (CHEBI:37156) is a hydrogen butenedioate (CHEBI:37155) |
| butenedioic acid (CHEBI:22958) is conjugate acid of hydrogen butenedioate (CHEBI:37155) |
| butenedioate (CHEBI:36180) is conjugate base of hydrogen butenedioate (CHEBI:37155) |
| IUPAC Name |
|---|
| 3-carboxyprop-2-enoate |
| Synonym | Source |
|---|---|
| 3-carboxyacrylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1342303 | Gmelin |
| Beilstein:5244783 | Beilstein |