EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3O4 |
| Net Charge | -1 |
| Average Mass | 115.064 |
| Monoisotopic Mass | 115.00368 |
| SMILES | O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-1/b2-1+ |
| InChIKey | VZCYOOQTPOCHFL-OWOJBTEDSA-M |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumarate(1−) (CHEBI:37154) has role fundamental metabolite (CHEBI:78675) |
| fumarate(1−) (CHEBI:37154) is a hydrogen butenedioate (CHEBI:37155) |
| fumarate(1−) (CHEBI:37154) is conjugate acid of fumarate(2−) (CHEBI:29806) |
| fumarate(1−) (CHEBI:37154) is conjugate base of fumaric acid (CHEBI:18012) |
| Incoming Relation(s) |
| ketotifen fumarate (CHEBI:31750) has part fumarate(1−) (CHEBI:37154) |
| monosodium fumarate (CHEBI:115087) has part fumarate(1−) (CHEBI:37154) |
| Ro 48-8071 fumarate (CHEBI:101097) has part fumarate(1−) (CHEBI:37154) |
| fumaric acid (CHEBI:18012) is conjugate acid of fumarate(1−) (CHEBI:37154) |
| fumarate(2−) (CHEBI:29806) is conjugate base of fumarate(1−) (CHEBI:37154) |
| IUPAC Name |
|---|
| (2E)-3-carboxyprop-2-enoate |
| Synonyms | Source |
|---|---|
| (2E)-3-carboxyacrylate | IUPAC |
| hydrogen fumarate | ChEBI |
| fumarate monoanion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:325290 | Gmelin |
| Reaxys:1906438 | Reaxys |