EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20NOS.C4H3O4 |
| Net Charge | 0 |
| Average Mass | 425.506 |
| Monoisotopic Mass | 425.12969 |
| SMILES | C[NH+]1CCC(=C2c3ccccc3CC(=O)c3sccc32)CC1.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C19H19NOS.C4H4O4/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19;5-3(6)1-2-4(7)8/h2-5,8,11H,6-7,9-10,12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | YNQQEYBLVYAWNX-WLHGVMLRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-asthmatic drug A drug used to treat asthma. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ketotifen fumarate (CHEBI:31750) has part fumarate(1−) (CHEBI:37154) |
| ketotifen fumarate (CHEBI:31750) has part ketotifen(1+) (CHEBI:140417) |
| ketotifen fumarate (CHEBI:31750) has role anti-asthmatic drug (CHEBI:49167) |
| ketotifen fumarate (CHEBI:31750) has role H1-receptor antagonist (CHEBI:37955) |
| ketotifen fumarate (CHEBI:31750) is a organoammonium salt (CHEBI:46850) |
| Manual Xrefs | Databases |
|---|---|
| D01332 | KEGG DRUG |
| HMDB0015056 | HMDB |
| Ketotifen | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4089486 | Reaxys |
| CAS:34580-14-8 | KEGG COMPOUND |
| CAS:34580-14-8 | ChemIDplus |
| Citations |
|---|