EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27BrFNO2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 564.448 |
| Monoisotopic Mass | 563.13188 |
| SMILES | C=CCN(C)CCCCCCOc1ccc(C(=O)c2ccc(Br)cc2)c(F)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H27BrFNO2.C4H4O4/c1-3-14-26(2)15-6-4-5-7-16-28-20-12-13-21(22(25)17-20)23(27)18-8-10-19(24)11-9-18;5-3(6)1-2-4(7)8/h3,8-13,17H,1,4-7,14-16H2,2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XCYAYLWZCRGKDS-WLHGVMLRSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 5.4.99.7 (lanosterol synthase) inhibitor An EC 5.4.99.* (intramolecular transferase transferring other groups) inhibitor that interferes with the action of lanosterol synthase (EC 5.4.99.7). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ro 48-8071 fumarate (CHEBI:101097) has part fumarate(1−) (CHEBI:37154) |
| Ro 48-8071 fumarate (CHEBI:101097) has part Ro 48-8071(1+) (CHEBI:101224) |
| Ro 48-8071 fumarate (CHEBI:101097) has role antineoplastic agent (CHEBI:35610) |
| Ro 48-8071 fumarate (CHEBI:101097) has role EC 5.4.99.7 (lanosterol synthase) inhibitor (CHEBI:101086) |
| Ro 48-8071 fumarate (CHEBI:101097) is a fumarate salt (CHEBI:50921) |
| IUPAC Names |
|---|
| (4-bromophenyl)[2-fluoro-4-({6-[methyl(prop-2-en-1-yl)amino]hexyl}oxy)phenyl]methanone (2E)-but-2-enedioate |
| 6-[4-(4-bromobenzoyl)-3-fluorophenoxy]-N-methyl-N-(prop-2-en-1-yl)hexan-1-aminium (2E)-3-carboxyprop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9462030 | Reaxys |
| CAS:189197-69-1 | ChemIDplus |
| Citations |
|---|