EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3O4.Na |
| Net Charge | 0 |
| Average Mass | 138.054 |
| Monoisotopic Mass | 137.99290 |
| SMILES | O=C([O-])/C=C/C(=O)O.[Na+] |
| InChI | InChI=1S/C4H4O4.Na/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+1/p-1/b2-1+; |
| InChIKey | VRVKOZSIJXBAJG-TYYBGVCCSA-M |
| Roles Classification |
|---|
| Chemical Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Biological Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monosodium fumarate (CHEBI:115087) has part fumarate(1−) (CHEBI:37154) |
| monosodium fumarate (CHEBI:115087) has role food acidity regulator (CHEBI:64049) |
| monosodium fumarate (CHEBI:115087) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (2E)-3-carboxyprop-2-enoate |
| Synonyms | Source |
|---|---|
| sodium hydrofumarate | ChEBI |
| Sodium hydrogen fumarate | ChemIDplus |
| Citations |
|---|