EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44N7O17P3S |
| Net Charge | 0 |
| Average Mass | 851.659 |
| Monoisotopic Mass | 851.17272 |
| SMILES | CCC(C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C26H44N7O17P3S/c1-5-14(2)25(38)54-9-8-28-16(34)6-7-29-23(37)20(36)26(3,4)11-47-53(44,45)50-52(42,43)46-10-15-19(49-51(39,40)41)18(35)24(48-15)33-13-32-17-21(27)30-12-31-22(17)33/h12-15,18-20,24,35-36H,5-11H2,1-4H3,(H,28,34)(H,29,37)(H,42,43)(H,44,45)(H2,27,30,31)(H2,39,40,41)/t14?,15-,18-,19-,20+,24-/m1/s1 |
| InChIKey | LYNVNYDEQMMNMZ-XGXNYEOVSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbutanoyl-CoA (CHEBI:15477) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| 2-methylbutanoyl-CoA (CHEBI:15477) has functional parent coenzyme A (CHEBI:15346) |
| 2-methylbutanoyl-CoA (CHEBI:15477) is a methyl-branched fatty acyl-CoA (CHEBI:25271) |
| 2-methylbutanoyl-CoA (CHEBI:15477) is a short-chain fatty acyl-CoA (CHEBI:61905) |
| 2-methylbutanoyl-CoA (CHEBI:15477) is conjugate acid of 2-methylbutanoyl-CoA(4−) (CHEBI:57336) |
| Incoming Relation(s) |
| (S)-2-methylbutanoyl-CoA (CHEBI:90222) is a 2-methylbutanoyl-CoA (CHEBI:15477) |
| 2-methylbutanoyl-CoA(4−) (CHEBI:57336) is conjugate base of 2-methylbutanoyl-CoA (CHEBI:15477) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(2-methylbutanoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 2-Methylbutanoyl-CoA | KEGG COMPOUND |
| 2-methylbutanoyl-coenzyme A | ChEBI |
| 2-Methylbutyryl-CoA | KEGG COMPOUND |
| 2-methylbutyryl-coenzyme A | ChEBI |
| S-(2-methylbutanoyl)-CoA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-METHYL-BUTYRYL-COA | MetaCyc |
| C01033 | KEGG COMPOUND |
| HMDB0001041 | HMDB |
| Citations |
|---|