EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO3 |
| Net Charge | 0 |
| Average Mass | 159.185 |
| Monoisotopic Mass | 159.08954 |
| SMILES | CCC(C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C7H13NO3/c1-3-5(2)7(11)8-4-6(9)10/h5H,3-4H2,1-2H3,(H,8,11)(H,9,10) |
| InChIKey | HOACIBQKYRHBOW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24023812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-methylbutanoyl)glycine (CHEBI:86366) has functional parent 2-methylbutyric acid (CHEBI:37070) |
| N-(2-methylbutanoyl)glycine (CHEBI:86366) has role human metabolite (CHEBI:77746) |
| N-(2-methylbutanoyl)glycine (CHEBI:86366) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| N-(2-methylbutanoyl)glycine |
| Synonyms | Source |
|---|---|
| 2-Methylbutyrylglycine | HMDB |
| alpha-Methylbutyrylglycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000339 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2206207 | Reaxys |
| CAS:52320-67-9 | ChemIDplus |
| Citations |
|---|