EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N2 |
| Net Charge | 0 |
| Average Mass | 360.545 |
| Monoisotopic Mass | 360.25655 |
| SMILES | [H][C@]1(C[C@@]2([H])NCCc3ccccc32)C[C@@]2([H])c3ccccc3CCN2C[C@@H]1CC |
| InChI | InChI=1S/C25H32N2/c1-2-18-17-27-14-12-20-8-4-6-10-23(20)25(27)16-21(18)15-24-22-9-5-3-7-19(22)11-13-26-24/h3-10,18,21,24-26H,2,11-17H2,1H3/t18-,21-,24+,25-/m0/s1 |
| InChIKey | KSQYVPHTTWSOHG-CKBKHPSWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emetan (CHEBI:36380) is a isoquinoline alkaloid (CHEBI:24921) |
| emetan (CHEBI:36380) is a isoquinoline alkaloid fundamental parent (CHEBI:38515) |
| emetan (CHEBI:36380) is a isoquinolines (CHEBI:24922) |
| Incoming Relation(s) |
| alangicine (CHEBI:2535) has parent hydride emetan (CHEBI:36380) |
| cephaeline (CHEBI:3533) has parent hydride emetan (CHEBI:36380) |
| dehydroemetine (CHEBI:149634) has parent hydride emetan (CHEBI:36380) |
| emetine (CHEBI:4781) has parent hydride emetan (CHEBI:36380) |
| klugine (CHEBI:66147) has parent hydride emetan (CHEBI:36380) |
| IUPAC Name |
|---|
| emetan |