EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36N2O5 |
| Net Charge | 0 |
| Average Mass | 468.594 |
| Monoisotopic Mass | 468.26242 |
| SMILES | [H][C@@]12C[C@H](C[C@@]3(O)NCCc4cc(O)c(OC)cc43)[C@@H](CC)CN1CCc1cc(O)c(OC)cc12 |
| InChI | InChI=1S/C27H36N2O5/c1-4-16-15-29-8-6-17-10-23(30)25(33-2)12-20(17)22(29)9-19(16)14-27(32)21-13-26(34-3)24(31)11-18(21)5-7-28-27/h10-13,16,19,22,28,30-32H,4-9,14-15H2,1-3H3/t16-,19+,22-,27-/m0/s1 |
| InChIKey | IIFHKWNCTVOSKL-OKGGWNPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psychotria klugii (IPNI:212953-2) | whole plant (BTO:0001461) | PubMed (12880315) |
| Roles Classification |
|---|
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| klugine (CHEBI:66147) has parent hydride emetan (CHEBI:36380) |
| klugine (CHEBI:66147) has role antileishmanial agent (CHEBI:70868) |
| klugine (CHEBI:66147) has role antiplasmodial drug (CHEBI:64915) |
| klugine (CHEBI:66147) has role metabolite (CHEBI:25212) |
| klugine (CHEBI:66147) is a isoquinoline alkaloid (CHEBI:24921) |
| klugine (CHEBI:66147) is a isoquinolinol (CHEBI:24923) |
| klugine (CHEBI:66147) is a pyridoisoquinoline (CHEBI:61692) |
| klugine (CHEBI:66147) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 7',11-dimethoxyemetan-1',6',10-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9677142 | Reaxys |
| Citations |
|---|