EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N2O4 |
| Net Charge | 0 |
| Average Mass | 478.633 |
| Monoisotopic Mass | 478.28316 |
| SMILES | [H][C@@]12CC(C[C@H]3NCCc4cc(OC)c(OC)cc43)=C(CC)CN1CCc1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C29H38N2O4/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24/h13-16,24-25,30H,6-12,17H2,1-5H3/t24-,25+/m1/s1 |
| InChIKey | XXLZPUYGHQWHRN-RPBOFIJWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroemetine (CHEBI:149634) has parent hydride emetan (CHEBI:36380) |
| dehydroemetine (CHEBI:149634) has role antileishmanial agent (CHEBI:70868) |
| dehydroemetine (CHEBI:149634) has role antimalarial (CHEBI:38068) |
| dehydroemetine (CHEBI:149634) has role antiprotozoal drug (CHEBI:35820) |
| dehydroemetine (CHEBI:149634) is a aromatic ether (CHEBI:35618) |
| dehydroemetine (CHEBI:149634) is a isoquinolines (CHEBI:24922) |
| dehydroemetine (CHEBI:149634) is a pyridoisoquinoline (CHEBI:61692) |
| IUPAC Name |
|---|
| 6',7',10,11-tetramethoxy-2,3-didehydroemetan |
| INNs | Source |
|---|---|
| dehidroemetina | WHO MedNet |
| dehydroemetine | WHO MedNet |
| déhydroémétine | WHO MedNet |
| dehydroemetinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-2,3-dehydroemetine | ChemIDplus |
| 2,3-didehydro-6',7',10,11-tetramethoxyemetan | ChemIDplus |
| 2,3-didehydroemetine | ChemIDplus |
| 2-dehydroemetine | ChemIDplus |
| BT 436 | ChemIDplus |
| (−)-R,S-dehydroemetine | ChEBI |
| Brand Names | Source |
|---|---|
| Dametin | ChEBI |
| Mebadin | KEGG DRUG |
| Mebadine | ChEBI |
| Citations |
|---|