EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N2O4 |
| Net Charge | 0 |
| Average Mass | 466.622 |
| Monoisotopic Mass | 466.28316 |
| SMILES | [H][C@]1(C[C@@]2([H])NCCc3cc(O)c(OC)cc32)C[C@@]2([H])c3cc(OC)c(OC)cc3CCN2C[C@@H]1CC |
| InChI | InChI=1S/C28H38N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,23-24,29,31H,5-11,16H2,1-4H3/t17-,20-,23+,24-/m0/s1 |
| InChIKey | DTGZHCFJNDAHEN-OZEXIGSWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephaeline (CHEBI:3533) has parent hydride emetan (CHEBI:36380) |
| cephaeline (CHEBI:3533) is a pyridoisoquinoline (CHEBI:61692) |
| cephaeline (CHEBI:3533) is conjugate base of cephaeline(2+) (CHEBI:231587) |
| Incoming Relation(s) |
| emetine (CHEBI:4781) has functional parent cephaeline (CHEBI:3533) |
| cephaeline(2+) (CHEBI:231587) is conjugate acid of cephaeline (CHEBI:3533) |
| IUPAC Name |
|---|
| 7',10,11-trimethoxyemetan-6'-ol |
| Synonyms | Source |
|---|---|
| Cephaelin | ChemIDplus |
| Cephaeline | KEGG COMPOUND |
| Citations |
|---|