EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | [H]C(=CC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C6H8O4/c7-5(8)3-1-2-4-6(9)10/h1,3H,2,4H2,(H,7,8)(H,9,10) |
| InChIKey | HSBSUGYTMJWPAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hexenedioic acid (CHEBI:36192) is a hexenedioic acid (CHEBI:25789) |
| 2-hexenedioic acid (CHEBI:36192) is conjugate acid of hex-2-enedioate (CHEBI:25781) |
| Incoming Relation(s) |
| (Z)-2,3-dehydroadipoyl-CoA (CHEBI:68471) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| (Z)-5-oxohex-2-enedioic acid (CHEBI:32808) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| 2,3-didehydroadipoyl-CoA (CHEBI:71163) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| 2,3,5-trichloromaleylacetic acid (CHEBI:19297) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| 4-oxohex-2-enedioic acid (CHEBI:19672) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| trans-2-hexenedioic acid (CHEBI:49296) is a 2-hexenedioic acid (CHEBI:36192) |
| hex-2-enedioate (CHEBI:25781) is conjugate base of 2-hexenedioic acid (CHEBI:36192) |
| IUPAC Name |
|---|
| hex-2-enedioic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722916 | Reaxys |