EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | O=C(O)/C=C/CCC(=O)O |
| InChI | InChI=1S/C6H8O4/c7-5(8)3-1-2-4-6(9)10/h1,3H,2,4H2,(H,7,8)(H,9,10)/b3-1+ |
| InChIKey | HSBSUGYTMJWPAX-HNQUOIGGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-hexenedioic acid (CHEBI:49296) is a 2-hexenedioic acid (CHEBI:36192) |
| IUPAC Name |
|---|
| (2E)-hex-2-enedioic acid |
| Synonyms | Source |
|---|---|
| (E)-hex-2-enedioic acid | ChEBI |
| trans-2,3-dehydroadipic acid | ChEBI |
| trans-2,3-didehydroadipic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4174728 | Beilstein |
| Citations |
|---|