EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H3Cl3O5 |
| Net Charge | 0 |
| Average Mass | 261.444 |
| Monoisotopic Mass | 259.90461 |
| SMILES | O=C(O)/C(Cl)=C(/Cl)C(=O)C(Cl)C(=O)O |
| InChI | InChI=1S/C6H3Cl3O5/c7-1(2(8)5(11)12)4(10)3(9)6(13)14/h3H,(H,11,12)(H,13,14)/b2-1- |
| InChIKey | ADCWUQBAGPEBME-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5-trichloromaleylacetic acid (CHEBI:19297) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| 2,3,5-trichloromaleylacetic acid (CHEBI:19297) is a organochlorine compound (CHEBI:36683) |
| 2,3,5-trichloromaleylacetic acid (CHEBI:19297) is a oxo dicarboxylic acid (CHEBI:36145) |
| IUPAC Name |
|---|
| (2Z)-2,3,5-trichloro-4-oxohex-2-enedioic acid |