EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O5 |
| Net Charge | 0 |
| Average Mass | 158.109 |
| Monoisotopic Mass | 158.02152 |
| SMILES | [H]C(C(=O)O)=C([H])C(=O)CC(=O)O |
| InChI | InChI=1S/C6H6O5/c7-4(3-6(10)11)1-2-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11) |
| InChIKey | SOXXPQLIZIPMIZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxohex-2-enedioic acid (CHEBI:19672) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| 4-oxohex-2-enedioic acid (CHEBI:19672) is a oxo dicarboxylic acid (CHEBI:36145) |
| 4-oxohex-2-enedioic acid (CHEBI:19672) is conjugate acid of 4-oxohex-2-enedioate (CHEBI:12040) |
| Incoming Relation(s) |
| 2,5-dichloro-4-oxohex-2-enedioic acid (CHEBI:31074) has functional parent 4-oxohex-2-enedioic acid (CHEBI:19672) |
| fumarylacetic acid (CHEBI:37160) is a 4-oxohex-2-enedioic acid (CHEBI:19672) |
| maleylacetic acid (CHEBI:1184) is a 4-oxohex-2-enedioic acid (CHEBI:19672) |
| 4-oxohex-2-enedioate (CHEBI:12040) is conjugate base of 4-oxohex-2-enedioic acid (CHEBI:19672) |
| IUPAC Name |
|---|
| 4-oxohex-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| Maleylacetic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8404489 | Beilstein |