EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O5 |
| Net Charge | 0 |
| Average Mass | 158.109 |
| Monoisotopic Mass | 158.02152 |
| SMILES | O=C(O)/C=C\CC(=O)C(=O)O |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1,3H,2H2,(H,8,9)(H,10,11)/b3-1- |
| InChIKey | OOEDHTCVMHDXRH-IWQZZHSRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-5-oxohex-2-enedioic acid (CHEBI:32808) has functional parent 2-hexenedioic acid (CHEBI:36192) |
| (Z)-5-oxohex-2-enedioic acid (CHEBI:32808) is a oxo dicarboxylic acid (CHEBI:36145) |
| (Z)-5-oxohex-2-enedioic acid (CHEBI:32808) is conjugate acid of (Z)-5-oxohex-2-enedioate (CHEBI:16967) |
| Incoming Relation(s) |
| (Z)-5-oxohex-2-enedioate (CHEBI:16967) is conjugate base of (Z)-5-oxohex-2-enedioic acid (CHEBI:32808) |
| IUPAC Name |
|---|
| (2Z)-5-oxohex-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 4-oxalocrotonic acid | ChEBI |
| (Z)-5-Oxohex-2-enedioate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03453 | KEGG COMPOUND |
| Citations |
|---|